Products 848413-99-0

CAS 848413-99-0 is the registry number for 1-benzyl 3-ethyl pyrrolidine-1,3-dicarboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

1-O-benzyl 3-O-ethyl pyrrolidine-1,3-dicarboxylate (CAS 848413-99-0) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 1-O-benzyl 3-O-ethyl pyrrolidine-1,3-dicarboxylate. InChIKey: PXTGBVCFUXOCMF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19NO4
Molecular weight277.31 g/mol
IUPAC name1-O-benzyl 3-O-ethyl pyrrolidine-1,3-dicarboxylate
InChIKeyPXTGBVCFUXOCMF-UHFFFAOYSA-N
SMILESCCOC(=O)C1CCN(C1)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)