CAS 84885-43-8 appears in our catalog under these names: Primaquine Impurity 5, Carboxyprimaquine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
1-(6-methoxyquinolin-8-yl)-5-methylpyrrolidin-2-one (CAS 84885-43-8) is a chemical compound with the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. IUPAC name: 1-(6-methoxyquinolin-8-yl)-5-methylpyrrolidin-2-one. InChIKey: CZNSNJWVRQAYNX-UHFFFAOYSA-N.
| Molecular formula | C15H16N2O2 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 1-(6-methoxyquinolin-8-yl)-5-methylpyrrolidin-2-one |
| InChIKey | CZNSNJWVRQAYNX-UHFFFAOYSA-N |
| SMILES | CC1CCC(=O)N1C2=C3C(=CC(=C2)OC)C=CC=N3 |
Computed by PubChem (NCBI)