CAS 849021-07-4 is the registry number for 6-(Chloromethyl)-2,3-dihydro-1H,5H-pyrido[3,2,1-ij]-quinolin-5-one, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
3-(chloromethyl)-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one (CAS 849021-07-4) is a chemical compound with the molecular formula C13H12ClNO and a molecular weight of 233.69 g/mol. IUPAC name: 3-(chloromethyl)-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one. InChIKey: XCPNBFVIMZKMHY-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 3-(chloromethyl)-1-azatricyclo[7.3.1.05,13]trideca-3,5(13),6,8-tetraen-2-one |
| InChIKey | XCPNBFVIMZKMHY-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC3=C2N(C1)C(=O)C(=C3)CCl |
Computed by PubChem (NCBI)