CAS 849021-40-5 is the registry number for 2-(4-Chlorophenoxy)malondialdehyde, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 25g.
2-(4-chlorophenoxy)propanedial (CAS 849021-40-5) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: 2-(4-chlorophenoxy)propanedial. InChIKey: PXSIXELVDKBAKQ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 2-(4-chlorophenoxy)propanedial |
| InChIKey | PXSIXELVDKBAKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC(C=O)C=O)Cl |
Computed by PubChem (NCBI)