CAS 849206-42-4 is the registry number for Olmesartan Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one (CAS 849206-42-4) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one. InChIKey: DZDICYVKNPSJCQ-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one |
| InChIKey | DZDICYVKNPSJCQ-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=C(N1)C(OC2=O)(C)C |
Computed by PubChem (NCBI)