CAS 849217-23-8 appears in our catalog under these names: 4–Quinolinol， 6–methoxy–7–(phenylmethoxy)–, 7-(Benzyloxy)-6-methoxyquinolin-4-ol 98%, 7-(Benzyloxy)-6-methoxyquinolin-4-ol, 98%, 98%, 7-(benzyloxy)-6-methoxy-1,4-dihydroquinolin-4-one, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-methoxy-7-phenylmethoxy-1H-quinolin-4-one (CAS 849217-23-8) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: 6-methoxy-7-phenylmethoxy-1H-quinolin-4-one. InChIKey: OXRDTRDGXMHOOV-UHFFFAOYSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 6-methoxy-7-phenylmethoxy-1H-quinolin-4-one |
| InChIKey | OXRDTRDGXMHOOV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C=CN2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)