Products 84937-82-6
CAS 84937-82-6 appears in our catalog under these names: Methyl 2，6–difluoro–4–methoxybenzoate, Methyl 2,6-difluoro-4-methoxybenzoate, 97%, 97%, Methyl 2,6-difluoro-4-methoxybenzoate, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg.
Methyl 2,6-difluoro-4-methoxybenzoate (CAS 84937-82-6) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: methyl 2,6-difluoro-4-methoxybenzoate. InChIKey: JUYBUWPEAIKESH-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | methyl 2,6-difluoro-4-methoxybenzoate |
| InChIKey | JUYBUWPEAIKESH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)F)C(=O)OC)F |
Computed by PubChem (NCBI)