CAS 849440-33-1 appears in our catalog under these names: (2S)-2-[(tert-Butoxy)carbonylamino]-3-(3,5-dimethylphenyl)propanoic acid, 95%, Boc–Phe(3,5–Me)–OH, Boc-L-Phe(3,5-Me2)-OH, Boc-Phe(3,5-Me)-OH, 98%, 98%, Boc-Phe(3,5-Me)-OH, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(2S)-3-(3,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 849440-33-1) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: (2S)-3-(3,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: YTXNDRYCIWRWPG-ZDUSSCGKSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | (2S)-3-(3,5-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | YTXNDRYCIWRWPG-ZDUSSCGKSA-N |
| SMILES | CC1=CC(=CC(=C1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)