Products 84946-10-1
CAS 84946-10-1 is the registry number for 2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolane, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolane (CAS 84946-10-1) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolane. InChIKey: HAXWHYNRHOLHCE-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-2-methyl-1,3-dioxolane |
| InChIKey | HAXWHYNRHOLHCE-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)