CAS 85002-76-2 is the registry number for (1-Methylcyclohexanyl)methyl-4-nitrophenyl Ether. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
1-[(1-methylcyclohexyl)methoxy]-4-nitrobenzene (CAS 85002-76-2) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: 1-[(1-methylcyclohexyl)methoxy]-4-nitrobenzene. InChIKey: PUXZSURAFWGSTM-UHFFFAOYSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | 1-[(1-methylcyclohexyl)methoxy]-4-nitrobenzene |
| InChIKey | PUXZSURAFWGSTM-UHFFFAOYSA-N |
| SMILES | CC1(CCCCC1)COC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)