Products 850568-35-3
CAS 850568-35-3 is the registry number for 2-Fluoro-4-isopropoxyaniline hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-fluoro-4-propan-2-yloxyaniline;hydrochloride (CAS 850568-35-3) is a chemical compound with the molecular formula C9H13ClFNO and a molecular weight of 205.66 g/mol. IUPAC name: 2-fluoro-4-propan-2-yloxyaniline;hydrochloride. InChIKey: OWTZAMYNRDYUMX-UHFFFAOYSA-N.
| Molecular formula | C9H13ClFNO |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | 2-fluoro-4-propan-2-yloxyaniline;hydrochloride |
| InChIKey | OWTZAMYNRDYUMX-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C=C1)N)F.Cl |
Computed by PubChem (NCBI)