Products 850568-36-4

CAS 850568-36-4 is the registry number for 2-Ethoxy-4-fluoroaniline hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.

Structural formula: {0} (CAS {1})

2-ethoxy-4-fluoroaniline;hydrochloride (CAS 850568-36-4) is a chemical compound with the molecular formula C8H11ClFNO and a molecular weight of 191.63 g/mol. IUPAC name: 2-ethoxy-4-fluoroaniline;hydrochloride. InChIKey: QHJRIDOJLJQKLU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11ClFNO
Molecular weight191.63 g/mol
IUPAC name2-ethoxy-4-fluoroaniline;hydrochloride
InChIKeyQHJRIDOJLJQKLU-UHFFFAOYSA-N
SMILESCCOC1=C(C=CC(=C1)F)N.Cl

Computed by PubChem (NCBI)