CAS 850593-08-7 appears in our catalog under these names: (3–(2,2,2–Trifluoroethoxy)phenyl)boronic acid, (3-(2,2,2-Trifluoroethoxy)phenyl)boronic acid, 98%, 98%, (3-(2,2,2-Trifluoroethoxy)phenyl)boronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
[3-(2,2,2-trifluoroethoxy)phenyl]boronic acid (CAS 850593-08-7) is a chemical compound with the molecular formula C8H8BF3O3 and a molecular weight of 219.96 g/mol. IUPAC name: [3-(2,2,2-trifluoroethoxy)phenyl]boronic acid. InChIKey: SZLRKQKOUYNFDB-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3 |
|---|---|
| Molecular weight | 219.96 g/mol |
| IUPAC name | [3-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
| InChIKey | SZLRKQKOUYNFDB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)