CAS 85094-13-9 is the registry number for 3–Methyl–1,4–diphenylpyrano(2,3–c)pyrazol–6(1H)–one. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
3-methyl-1,4-diphenylpyrano[3,2-d]pyrazol-6-one (CAS 85094-13-9) is a chemical compound with the molecular formula C19H14N2O2 and a molecular weight of 302.3 g/mol. IUPAC name: 3-methyl-1,4-diphenylpyrano[3,2-d]pyrazol-6-one. InChIKey: PCKPUWXZDWJNMI-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O2 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | 3-methyl-1,4-diphenylpyrano[3,2-d]pyrazol-6-one |
| InChIKey | PCKPUWXZDWJNMI-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=O)O2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)