Products 851292-43-8
CAS 851292-43-8 is the registry number for 1-{((9H-fluoren-9-yl)methoxy)carbonyl}-1,2,5,6-tetrahydropyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(9H-fluoren-9-ylmethoxycarbonyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid (CAS 851292-43-8) is a chemical compound with the molecular formula C21H19NO4 and a molecular weight of 349.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid. InChIKey: BVZYISLKDUHKRZ-UHFFFAOYSA-N.
| Molecular formula | C21H19NO4 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)-3,6-dihydro-2H-pyridine-5-carboxylic acid |
| InChIKey | BVZYISLKDUHKRZ-UHFFFAOYSA-N |
| SMILES | C1CN(CC(=C1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)