Products 851398-61-3
CAS 851398-61-3 is the registry number for 8-Chloro-2,3-dihydro-1,4-benzodioxine-6-carbaldehyde. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbaldehyde (CAS 851398-61-3) is a chemical compound with the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbaldehyde. InChIKey: QNMGAQWLVFYMGX-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbaldehyde |
| InChIKey | QNMGAQWLVFYMGX-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C=C2Cl)C=O |
Computed by PubChem (NCBI)