Products 851476-62-5

CAS 851476-62-5 is the registry number for Glycine-13C2-15N, N-(phenylmethyl) Methyl Ester. Offered by: TRC. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

Methyl 2-(benzyl(15N)amino)acetate (CAS 851476-62-5) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 182.19 g/mol. IUPAC name: methyl 2-(benzyl(15N)amino)acetate. InChIKey: UAWVZBDVSNLPDT-HLDOMDIUSA-N.

Identity
Molecular formulaC10H13NO2
Molecular weight182.19 g/mol
IUPAC namemethyl 2-(benzyl(15N)amino)acetate
InChIKeyUAWVZBDVSNLPDT-HLDOMDIUSA-N
SMILESCO[13C](=O)[13CH2][15NH]CC1=CC=CC=C1

Computed by PubChem (NCBI)