CAS 851476-62-5 is the registry number for Glycine-13C2-15N, N-(phenylmethyl) Methyl Ester. Offered by: TRC. Available pack sizes: 25mg.
Methyl 2-(benzyl(15N)amino)acetate (CAS 851476-62-5) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 182.19 g/mol. IUPAC name: methyl 2-(benzyl(15N)amino)acetate. InChIKey: UAWVZBDVSNLPDT-HLDOMDIUSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | methyl 2-(benzyl(15N)amino)acetate |
| InChIKey | UAWVZBDVSNLPDT-HLDOMDIUSA-N |
| SMILES | CO[13C](=O)[13CH2][15NH]CC1=CC=CC=C1 |
Computed by PubChem (NCBI)