CAS 851682-16-1 appears in our catalog under these names: 5-Methyl-5H,6H,7H-furo(2,3-f)indol-6-one, 95%, 5-Methyl-5H,6H,7H-furo(2,3-F)indol-6-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-methyl-7H-furo[2,3-f]indol-6-one (CAS 851682-16-1) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 5-methyl-7H-furo[2,3-f]indol-6-one. InChIKey: NAAWMJRLCVUWDG-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 5-methyl-7H-furo[2,3-f]indol-6-one |
| InChIKey | NAAWMJRLCVUWDG-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC2=C1C=C3C=COC3=C2 |
Computed by PubChem (NCBI)