CAS 851726-57-3 appears in our catalog under these names: 2-((tert-Butoxycarbonyl)(4-fluorobenzyl)amino)acetic acid, 95%, 2-((tert-Butoxycarbonyl)(4-fluorobenzyl)amino)acetic acid, 95%, 95%, n-(Tert-butoxycarbonyl)-n-(4-fluorobenzyl)glycine, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 500mg, 2.5g.
2-[(4-fluorophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid (CAS 851726-57-3) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: 2-[(4-fluorophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid. InChIKey: PDUIHMJJVLDHKX-UHFFFAOYSA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetic acid |
| InChIKey | PDUIHMJJVLDHKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CC1=CC=C(C=C1)F)CC(=O)O |
Computed by PubChem (NCBI)