CAS 852138-89-7 appears in our catalog under these names: 4,4'-Dibromo-2,2'-diiodobiphenyl4,4'-Dibromo-2,2'-diiodobiphenyl, >96% (HPLC), 4,4’–Dibromo–2,2’–diiodobiphenyl, 4,4'-Dibromo-2,2'-diiodobiphenyl, >98.0%(GC), 4,4'-Dibromo-2,2'-diiodo-1,1'-biphenyl, 97%, 4,4'-Dibromo-2,2'-diiodo-1,1'-biphenyl, 95%. Offered by: Lumtec, GLPBio, TCI, Fluorochem, Ambeed. Available pack sizes: On request, 1g, 5g, 200mg, 250mg, 10g, 25g.
4-bromo-1-(4-bromo-2-iodophenyl)-2-iodobenzene (CAS 852138-89-7) is a chemical compound with the molecular formula C12H6Br2I2 and a molecular weight of 563.79 g/mol. IUPAC name: 4-bromo-1-(4-bromo-2-iodophenyl)-2-iodobenzene. InChIKey: JPXBIAWPJOGFCF-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2I2 |
|---|---|
| Molecular weight | 563.79 g/mol |
| IUPAC name | 4-bromo-1-(4-bromo-2-iodophenyl)-2-iodobenzene |
| InChIKey | JPXBIAWPJOGFCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)I)C2=C(C=C(C=C2)Br)I |
Computed by PubChem (NCBI)