Products 852139-02-7
CAS 852139-02-7 appears in our catalog under these names: 2,2'-Dibromo-5,5'-diiodo-1,1'-biphenyl, 98%, 98%, 2,2′-Dibromo-5,5′-diiodo-1,1′-biphenyl, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-bromo-2-(2-bromo-5-iodophenyl)-4-iodobenzene (CAS 852139-02-7) is a chemical compound with the molecular formula C12H6Br2I2 and a molecular weight of 563.79 g/mol. IUPAC name: 1-bromo-2-(2-bromo-5-iodophenyl)-4-iodobenzene. InChIKey: SXVVPRKANYYBOS-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2I2 |
|---|---|
| Molecular weight | 563.79 g/mol |
| IUPAC name | 1-bromo-2-(2-bromo-5-iodophenyl)-4-iodobenzene |
| InChIKey | SXVVPRKANYYBOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)C2=C(C=CC(=C2)I)Br)Br |
Computed by PubChem (NCBI)