CAS 873792-52-0 appears in our catalog under these names: 5,5'-Dibromo-2,2'-diiodo-1,1'-biphenyl, 95+%, 95+%, 5,5'-Dibromo-2,2'-diiodo-1,1'-biphenyl, 95+%. Offered by: Chemat, Ambeed. Available pack sizes: 1g.
4-bromo-2-(5-bromo-2-iodophenyl)-1-iodobenzene (CAS 873792-52-0) is a chemical compound with the molecular formula C12H6Br2I2 and a molecular weight of 563.79 g/mol. IUPAC name: 4-bromo-2-(5-bromo-2-iodophenyl)-1-iodobenzene. InChIKey: UQVSXZJWEBEYQC-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2I2 |
|---|---|
| Molecular weight | 563.79 g/mol |
| IUPAC name | 4-bromo-2-(5-bromo-2-iodophenyl)-1-iodobenzene |
| InChIKey | UQVSXZJWEBEYQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C2=C(C=CC(=C2)Br)I)I |
Computed by PubChem (NCBI)