CAS 852138-93-3 appears in our catalog under these names: 2,2'-Dibromo-4,4'-diiodo-1,1'-biphenyl, 95%, 2,2'–Dibromo–4,4'–diiodo–1,1'–biphenyl, 2,2'-Dibromo-4,4'-diiodo-1,1'-biphenyl, 95%, 95%, 2-Bromo-1-(2-bromo-4-iodophenyl)-4-iodobenzene, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
2-bromo-1-(2-bromo-4-iodophenyl)-4-iodobenzene (CAS 852138-93-3) is a chemical compound with the molecular formula C12H6Br2I2 and a molecular weight of 563.79 g/mol. IUPAC name: 2-bromo-1-(2-bromo-4-iodophenyl)-4-iodobenzene. InChIKey: MJZNAWMPPSJRJX-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2I2 |
|---|---|
| Molecular weight | 563.79 g/mol |
| IUPAC name | 2-bromo-1-(2-bromo-4-iodophenyl)-4-iodobenzene |
| InChIKey | MJZNAWMPPSJRJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)Br)C2=C(C=C(C=C2)I)Br |
Computed by PubChem (NCBI)