CAS 852367-82-9 is the registry number for N-(3,4-dimethoxyphenyl)-2-indol-3-yl-2-oxoethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)-2-oxoacetamide (CAS 852367-82-9) is a chemical compound with the molecular formula C18H16N2O4 and a molecular weight of 324.3 g/mol. IUPAC name: N-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)-2-oxoacetamide. InChIKey: KNVQOVQAHUQPJG-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O4 |
|---|---|
| Molecular weight | 324.3 g/mol |
| IUPAC name | N-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)-2-oxoacetamide |
| InChIKey | KNVQOVQAHUQPJG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NC(=O)C(=O)C2=CNC3=CC=CC=C32)OC |
Computed by PubChem (NCBI)