CAS 852392-18-8 appears in our catalog under these names: alpha-(Aminomethyl)-3-(trifluoromethoxy)benzenemethanol, 2-Amino-1-(3-(trifluoromethoxy)phenyl)ethan-1-ol. Offered by: TRC, Biosynth. Available pack sizes: 750mg, 50mg, 0,5g.
2-amino-1-[3-(trifluoromethoxy)phenyl]ethanol (CAS 852392-18-8) is a chemical compound with the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. IUPAC name: 2-amino-1-[3-(trifluoromethoxy)phenyl]ethanol. InChIKey: AQGZPXKBMIKDGM-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 2-amino-1-[3-(trifluoromethoxy)phenyl]ethanol |
| InChIKey | AQGZPXKBMIKDGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)C(CN)O |
Computed by PubChem (NCBI)