Products 85299-04-3
CAS 85299-04-3 appears in our catalog under these names: Phenylephrine Impurity 25, Phenylephrine Impurity 52, Phenylephrine Impurity 39. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2,2-dichloro-1-(3-hydroxyphenyl)ethanone (CAS 85299-04-3) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2,2-dichloro-1-(3-hydroxyphenyl)ethanone. InChIKey: RKNCCFJWELIYBJ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2,2-dichloro-1-(3-hydroxyphenyl)ethanone |
| InChIKey | RKNCCFJWELIYBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C(=O)C(Cl)Cl |
Computed by PubChem (NCBI)