Products 853724-02-4
CAS 853724-02-4 is the registry number for 2-(3-(Methoxycarbonyl)-1H-indol-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(3-methoxycarbonylindol-1-yl)acetic acid (CAS 853724-02-4) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 2-(3-methoxycarbonylindol-1-yl)acetic acid. InChIKey: RVDJXYPBINWDMV-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 2-(3-methoxycarbonylindol-1-yl)acetic acid |
| InChIKey | RVDJXYPBINWDMV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN(C2=CC=CC=C21)CC(=O)O |
Computed by PubChem (NCBI)