Products 854036-05-8
CAS 854036-05-8 is the registry number for 6-Bromo-3-(2-methoxyethyl)-2-sulfanyl-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
6-bromo-3-(2-methoxyethyl)-2-sulfanylidene-1H-quinazolin-4-one (CAS 854036-05-8) is a chemical compound with the molecular formula C11H11BrN2O2S and a molecular weight of 315.19 g/mol. IUPAC name: 6-bromo-3-(2-methoxyethyl)-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: AEHQTSXPPYYFGO-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2S |
|---|---|
| Molecular weight | 315.19 g/mol |
| IUPAC name | 6-bromo-3-(2-methoxyethyl)-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | AEHQTSXPPYYFGO-UHFFFAOYSA-N |
| SMILES | COCCN1C(=O)C2=C(C=CC(=C2)Br)NC1=S |
Computed by PubChem (NCBI)