CAS 854235-81-7 is the registry number for 4-Methyl-2-biphenylcarbonyl Chloride. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 250mg.
5-methyl-2-phenylbenzoyl chloride (CAS 854235-81-7) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 5-methyl-2-phenylbenzoyl chloride. InChIKey: QCEBKAVBSMVTRK-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 5-methyl-2-phenylbenzoyl chloride |
| InChIKey | QCEBKAVBSMVTRK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CC=CC=C2)C(=O)Cl |
Computed by PubChem (NCBI)