Products 854235-81-7

CAS 854235-81-7 is the registry number for 4-Methyl-2-biphenylcarbonyl Chloride. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 250mg.

Structural formula: {0} (CAS {1})

5-methyl-2-phenylbenzoyl chloride (CAS 854235-81-7) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 5-methyl-2-phenylbenzoyl chloride. InChIKey: QCEBKAVBSMVTRK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11ClO
Molecular weight230.69 g/mol
IUPAC name5-methyl-2-phenylbenzoyl chloride
InChIKeyQCEBKAVBSMVTRK-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C2=CC=CC=C2)C(=O)Cl

Computed by PubChem (NCBI)