CAS 854762-47-3 appears in our catalog under these names: 4,7-Difluoroisoindolin-1-one, 97%, 4,7-Difluoro-2,3-dihydro-1H-isoindol-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,7-difluoro-2,3-dihydroisoindol-1-one (CAS 854762-47-3) is a chemical compound with the molecular formula C8H5F2NO and a molecular weight of 169.13 g/mol. IUPAC name: 4,7-difluoro-2,3-dihydroisoindol-1-one. InChIKey: FBIRCWQFZUEINW-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 4,7-difluoro-2,3-dihydroisoindol-1-one |
| InChIKey | FBIRCWQFZUEINW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2C(=O)N1)F)F |
Computed by PubChem (NCBI)