Products 855336-74-2
CAS 855336-74-2 is the registry number for 7-Chloro-2,3-dihydro-1,4-benzodioxin-6-amine. Offered by: Biosynth. Available pack sizes: 2,5g.
6-chloro-2,3-dihydro-1,4-benzodioxin-7-amine (CAS 855336-74-2) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 6-chloro-2,3-dihydro-1,4-benzodioxin-7-amine. InChIKey: ILWFWTIQKGSLGF-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 6-chloro-2,3-dihydro-1,4-benzodioxin-7-amine |
| InChIKey | ILWFWTIQKGSLGF-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Cl)N |
Computed by PubChem (NCBI)