Products 855358-43-9
CAS 855358-43-9 is the registry number for 4,4'-(Pyridin-2-ylmethylene)bis(2-methylphenol), 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-[(4-hydroxy-3-methylphenyl)-pyridin-2-ylmethyl]-2-methylphenol (CAS 855358-43-9) is a chemical compound with the molecular formula C20H19NO2 and a molecular weight of 305.4 g/mol. IUPAC name: 4-[(4-hydroxy-3-methylphenyl)-pyridin-2-ylmethyl]-2-methylphenol. InChIKey: LWGYJJFGHPSBRI-UHFFFAOYSA-N.
| Molecular formula | C20H19NO2 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 4-[(4-hydroxy-3-methylphenyl)-pyridin-2-ylmethyl]-2-methylphenol |
| InChIKey | LWGYJJFGHPSBRI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C2=CC(=C(C=C2)O)C)C3=CC=CC=N3)O |
Computed by PubChem (NCBI)