CAS 350997-41-0 is the registry number for 2-(4-Isobutylphenyl)quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[4-(2-methylpropyl)phenyl]quinoline-4-carboxylic acid (CAS 350997-41-0) is a chemical compound with the molecular formula C20H19NO2 and a molecular weight of 305.4 g/mol. IUPAC name: 2-[4-(2-methylpropyl)phenyl]quinoline-4-carboxylic acid. InChIKey: QIIGIVFDELUNTD-UHFFFAOYSA-N.
| Molecular formula | C20H19NO2 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 2-[4-(2-methylpropyl)phenyl]quinoline-4-carboxylic acid |
| InChIKey | QIIGIVFDELUNTD-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)O |
Computed by PubChem (NCBI)