Products 590355-50-3
CAS 590355-50-3 appears in our catalog under these names: 2-(2,4-Dimethylphenyl)-6-ethylquinoline-4-carboxylic acid, 95%, 2-(2,4-Dimethylphenyl)-6-ethylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(2,4-dimethylphenyl)-6-ethylquinoline-4-carboxylic acid (CAS 590355-50-3) is a chemical compound with the molecular formula C20H19NO2 and a molecular weight of 305.4 g/mol. IUPAC name: 2-(2,4-dimethylphenyl)-6-ethylquinoline-4-carboxylic acid. InChIKey: AVZSWCGZBAFBET-UHFFFAOYSA-N.
| Molecular formula | C20H19NO2 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 2-(2,4-dimethylphenyl)-6-ethylquinoline-4-carboxylic acid |
| InChIKey | AVZSWCGZBAFBET-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)N=C(C=C2C(=O)O)C3=C(C=C(C=C3)C)C |
Computed by PubChem (NCBI)