Products 932886-85-6
CAS 932886-85-6 appears in our catalog under these names: 3,6,8-Trimethyl-2-(4-methylphenyl)quinoline-4-carboxylic acid, 95%, 3,6,8-Trimethyl-2-(p-tolyl)quinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3,6,8-trimethyl-2-(4-methylphenyl)quinoline-4-carboxylic acid (CAS 932886-85-6) is a chemical compound with the molecular formula C20H19NO2 and a molecular weight of 305.4 g/mol. IUPAC name: 3,6,8-trimethyl-2-(4-methylphenyl)quinoline-4-carboxylic acid. InChIKey: MGHAUKLOIDHDFW-UHFFFAOYSA-N.
| Molecular formula | C20H19NO2 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 3,6,8-trimethyl-2-(4-methylphenyl)quinoline-4-carboxylic acid |
| InChIKey | MGHAUKLOIDHDFW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3C(=C2C)C(=O)O)C)C |
Computed by PubChem (NCBI)