Products 3652-61-7
CAS 3652-61-7 is the registry number for Ethyl 2-methyl-1,5-diphenylpyrrole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 2-methyl-1,5-diphenylpyrrole-3-carboxylate (CAS 3652-61-7) is a chemical compound with the molecular formula C20H19NO2 and a molecular weight of 305.4 g/mol. IUPAC name: ethyl 2-methyl-1,5-diphenylpyrrole-3-carboxylate. InChIKey: YHEGUULWFOVVRG-UHFFFAOYSA-N.
| Molecular formula | C20H19NO2 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | ethyl 2-methyl-1,5-diphenylpyrrole-3-carboxylate |
| InChIKey | YHEGUULWFOVVRG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C(=C1)C2=CC=CC=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)