Products 85545-61-5
CAS 85545-61-5 is the registry number for 5-(Dimethylamino)-1,3-dihydro-2H-benzimidazol-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(dimethylamino)-1,3-dihydrobenzimidazol-2-one (CAS 85545-61-5) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 5-(dimethylamino)-1,3-dihydrobenzimidazol-2-one. InChIKey: NKILMMMBFKZKGE-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 5-(dimethylamino)-1,3-dihydrobenzimidazol-2-one |
| InChIKey | NKILMMMBFKZKGE-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)NC(=O)N2 |
Computed by PubChem (NCBI)