CAS 85559-46-2 appears in our catalog under these names: 4-[3-(Trifluoromethyl)-3h-diazirin-3-yl]benzoic acid, 98%, 4-(3-(Trifluoromethyl)-3H-diazirin-3-yl)benzoic Acid, >95% (HPLC), 4–(3–(Trifluoromethyl)–3H–diazirin–3–yl)benzoic acid, Photo-Benzoic acid, 4-(3-(Trifluoromethyl)-3H-diazirin-3-yl)benzoic acid. Offered by: Combi-blocks, TRC, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 1g, 250mg, 10mg, 25mg, 100mg, 200mg, 500mg, 1000mg.
4-[3-(trifluoromethyl)diazirin-3-yl]benzoic acid (CAS 85559-46-2) is a chemical compound with the molecular formula C9H5F3N2O2 and a molecular weight of 230.14 g/mol. IUPAC name: 4-[3-(trifluoromethyl)diazirin-3-yl]benzoic acid. InChIKey: CZPAJVBVULSLGG-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O2 |
|---|---|
| Molecular weight | 230.14 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)diazirin-3-yl]benzoic acid |
| InChIKey | CZPAJVBVULSLGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)C2(N=N2)C(F)(F)F |
Computed by PubChem (NCBI)