CAS 855841-14-4 appears in our catalog under these names: 5-Chloro-2-phenyl-1,3-oxazole-4-carboxamide, 5-Chloro-2-phenyl-1,3-oxazole-4-carboxamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
5-chloro-2-phenyl-1,3-oxazole-4-carboxamide (CAS 855841-14-4) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: 5-chloro-2-phenyl-1,3-oxazole-4-carboxamide. InChIKey: BOOJFIOTCAUJQA-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | 5-chloro-2-phenyl-1,3-oxazole-4-carboxamide |
| InChIKey | BOOJFIOTCAUJQA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C(O2)Cl)C(=O)N |
Computed by PubChem (NCBI)