CAS 855997-37-4 appears in our catalog under these names: 7-​Bromo-​3,​4-​dihydro-2H-​1-benzothiopyran 1,​1-​dioxide, 7-Bromothiochromane 1,1-dioxide, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg.
7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide (CAS 855997-37-4) is a chemical compound with the molecular formula C9H9BrO2S and a molecular weight of 261.14 g/mol. IUPAC name: 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide. InChIKey: DMJMKTQTDONYHP-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2S |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | 7-bromo-3,4-dihydro-2H-thiochromene 1,1-dioxide |
| InChIKey | DMJMKTQTDONYHP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)Br)S(=O)(=O)C1 |
Computed by PubChem (NCBI)