Products 856074-98-1

CAS 856074-98-1 is the registry number for 1,8-Dihydroxynaphthalene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1,8-dihydroxynaphthalene-2-carboxylic acid (CAS 856074-98-1) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 1,8-dihydroxynaphthalene-2-carboxylic acid. InChIKey: XZBCNRVJDCCKBU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8O4
Molecular weight204.18 g/mol
IUPAC name1,8-dihydroxynaphthalene-2-carboxylic acid
InChIKeyXZBCNRVJDCCKBU-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)O)C(=C(C=C2)C(=O)O)O

Computed by PubChem (NCBI)