CAS 856074-98-1 is the registry number for 1,8-Dihydroxynaphthalene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,8-dihydroxynaphthalene-2-carboxylic acid (CAS 856074-98-1) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 1,8-dihydroxynaphthalene-2-carboxylic acid. InChIKey: XZBCNRVJDCCKBU-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 1,8-dihydroxynaphthalene-2-carboxylic acid |
| InChIKey | XZBCNRVJDCCKBU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=C(C=C2)C(=O)O)O |
Computed by PubChem (NCBI)