CAS 85633-52-9 appears in our catalog under these names: 4-(Pyridin-3-yloxy)phenol, 95%, 4-(Pyridin-3-yloxy)phenol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-pyridin-3-yloxyphenol (CAS 85633-52-9) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 4-pyridin-3-yloxyphenol. InChIKey: AWPCZCUJZRRDNK-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 4-pyridin-3-yloxyphenol |
| InChIKey | AWPCZCUJZRRDNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)OC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)