Products 85639-00-5

CAS 85639-00-5 is the registry number for 2-Chloro-4-hydroxy-4'-methyldiphenylamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

3-chloro-4-(4-methylanilino)phenol (CAS 85639-00-5) is a chemical compound with the molecular formula C13H12ClNO and a molecular weight of 233.69 g/mol. IUPAC name: 3-chloro-4-(4-methylanilino)phenol. InChIKey: KCCRUSHRLKIHRM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12ClNO
Molecular weight233.69 g/mol
IUPAC name3-chloro-4-(4-methylanilino)phenol
InChIKeyKCCRUSHRLKIHRM-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)NC2=C(C=C(C=C2)O)Cl

Computed by PubChem (NCBI)