CAS 856563-09-2 appears in our catalog under these names: 2,2,2–Trifluoro–1–(3–methoxyphenyl)ethanamine hydrochloride, 2,2,2-Trifluoro-1-(3-methoxyphenyl)ethanamine hydrochloride, 95+%, 95+%, 2,2,2-TRIFLUORO-1-(3-METHOXYPHENYL)ETHANAMINE HCL, 98%, 2,2,2-Trifluoro-1-(3-methoxyphenyl)ethanamine hydrochloride, 95+%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2,2,2-trifluoro-1-(3-methoxyphenyl)ethanamine;hydrochloride (CAS 856563-09-2) is a chemical compound with the molecular formula C9H11ClF3NO and a molecular weight of 241.64 g/mol. IUPAC name: 2,2,2-trifluoro-1-(3-methoxyphenyl)ethanamine;hydrochloride. InChIKey: RFVCBTAGVFWILZ-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3NO |
|---|---|
| Molecular weight | 241.64 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(3-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | RFVCBTAGVFWILZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)