Products 857005-81-3
CAS 857005-81-3 appears in our catalog under these names: 2-Amino-6-chloro-3-methylbenzoic acid, 2-Amino-6-chloro-3-methylbenzoic acid, 95%, 2-Amino-6-chloro-3-methylbenzoic Acid, 95+%, 2-Amino-6-chloro-3-methylbenzoic Acid, 95%, 95%. Offered by: Biosynth, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 0,1g, 0,05g, 0,25g, 1g, 0,5g, 250mg, 10g, 5g.
2-amino-6-chloro-3-methylbenzoic acid (CAS 857005-81-3) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-amino-6-chloro-3-methylbenzoic acid. InChIKey: QIZZHPAEYROYKH-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-amino-6-chloro-3-methylbenzoic acid |
| InChIKey | QIZZHPAEYROYKH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Cl)C(=O)O)N |
Computed by PubChem (NCBI)