CAS 857285-30-4 is the registry number for 4-Bromo-3,5-dimethoxybenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-bromo-3,5-dimethoxybenzamide (CAS 857285-30-4) is a chemical compound with the molecular formula C9H10BrNO3 and a molecular weight of 260.08 g/mol. IUPAC name: 4-bromo-3,5-dimethoxybenzamide. InChIKey: KQKQQRHOZQCRPZ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO3 |
|---|---|
| Molecular weight | 260.08 g/mol |
| IUPAC name | 4-bromo-3,5-dimethoxybenzamide |
| InChIKey | KQKQQRHOZQCRPZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1Br)OC)C(=O)N |
Computed by PubChem (NCBI)