CAS 857426-60-9 is the registry number for 3-(Indolizin-2-yl)aniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-indolizin-2-ylaniline (CAS 857426-60-9) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 3-indolizin-2-ylaniline. InChIKey: NLWIZLJDKPHLNQ-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 3-indolizin-2-ylaniline |
| InChIKey | NLWIZLJDKPHLNQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN2C=C1)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)