Products 857524-97-1
CAS 857524-97-1 is the registry number for 2-Amino-8-(2-chlorophenyl)-6,9-dihydro-1H-purin-6-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-8-(2-chlorophenyl)-1,7-dihydropurin-6-one (CAS 857524-97-1) is a chemical compound with the molecular formula C11H8ClN5O and a molecular weight of 261.67 g/mol. IUPAC name: 2-amino-8-(2-chlorophenyl)-1,7-dihydropurin-6-one. InChIKey: DQKYYUBIVQGUND-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN5O |
|---|---|
| Molecular weight | 261.67 g/mol |
| IUPAC name | 2-amino-8-(2-chlorophenyl)-1,7-dihydropurin-6-one |
| InChIKey | DQKYYUBIVQGUND-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=C(N2)C(=O)NC(=N3)N)Cl |
Computed by PubChem (NCBI)