Products 865658-74-8
CAS 865658-74-8 is the registry number for N-(2-Amino-1,2-dinitrilovinyl)((4-chlorophenyl)amino)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(4-chlorophenyl)urea (CAS 865658-74-8) is a chemical compound with the molecular formula C11H8ClN5O and a molecular weight of 261.67 g/mol. IUPAC name: 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(4-chlorophenyl)urea. InChIKey: JFUPPGJOKIIZBR-KTKRTIGZSA-N.
| Molecular formula | C11H8ClN5O |
|---|---|
| Molecular weight | 261.67 g/mol |
| IUPAC name | 1-[(Z)-2-amino-1,2-dicyanoethenyl]-3-(4-chlorophenyl)urea |
| InChIKey | JFUPPGJOKIIZBR-KTKRTIGZSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)N/C(=C(/C#N)\N)/C#N)Cl |
Computed by PubChem (NCBI)