CAS 857571-00-7 appears in our catalog under these names: N-(3,4-Dimethyl-5-nitrophenyl)acetamide, 95%, 4,5-Dimethyl-3-nitro-acetanilide. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
N-(3,4-dimethyl-5-nitrophenyl)acetamide (CAS 857571-00-7) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: N-(3,4-dimethyl-5-nitrophenyl)acetamide. InChIKey: GTLVZAMPWVMSGU-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | N-(3,4-dimethyl-5-nitrophenyl)acetamide |
| InChIKey | GTLVZAMPWVMSGU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)[N+](=O)[O-])NC(=O)C |
Computed by PubChem (NCBI)